C21H23N3O3 — CID 108815300
(Z)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(3-phenylpropylamino)prop-2-enamide (PubChem CID 108815300) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(3-phenylpropylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(3-phenylpropylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108815300 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (Z)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(3-phenylpropylamino)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C\NCCCc2ccccc2)cc1OC |
| InChI | InChI=1S/C21H23N3O3/c1-26-19-11-10-18(13-20(19)27-2)24-21(25)17(14-22)15-23-12-6-9-16-7-4-3-5-8-16/h3-5,7-8,10-11,13,15,23H,6,9,12H2,1-2H3,(H,24,25)/b17-15- |
| InChIKey | OMMMWHBVGSAPLU-ICFOKQHNSA-N |
| XLogP | 3.27 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|