C15H24N4O3 — CID 108815372
(Z)-2-cyano-3-(3-methoxypropylamino)-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide (PubChem CID 108815372) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3-methoxypropylamino)-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3-methoxypropylamino)-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 108815372 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (Z)-2-cyano-3-(3-methoxypropylamino)-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
| SMILES | COCCCN/C=C(/C#N)C(=O)NCCCN1CCCC1=O |
| InChI | InChI=1S/C15H24N4O3/c1-22-10-4-6-17-12-13(11-16)15(21)18-7-3-9-19-8-2-5-14(19)20/h12,17H,2-10H2,1H3,(H,18,21)/b13-12- |
| InChIKey | GOHQHLOOMBPWNZ-SEYXRHQNSA-N |
| XLogP | 0.15 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|