C22H24N2 — CID 10881632
2-[(1S,3S,4S,5R)-4-methyl-1-propan-2-yl-3-bicyclo[3.1.0]hexanyl]-1,10-phenanthroline (PubChem CID 10881632) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 2-[(1S,3S,4S,5R)-4-methyl-1-propan-2-yl-3-bicyclo[3.1.0]hexanyl]-1,10-phenanthroline.
| Compound Name | 2-[(1S,3S,4S,5R)-4-methyl-1-propan-2-yl-3-bicyclo[3.1.0]hexanyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 10881632 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2-[(1S,3S,4S,5R)-4-methyl-1-propan-2-yl-3-bicyclo[3.1.0]hexanyl]-1,10-phenanthroline |
| SMILES | CC(C)[C@]12C[C@H](c3ccc4ccc5cccnc5c4n3)[C@@H](C)[C@H]1C2 |
| InChI | InChI=1S/C22H24N2/c1-13(2)22-11-17(14(3)18(22)12-22)19-9-8-16-7-6-15-5-4-10-23-20(15)21(16)24-19/h4-10,13-14,17-18H,11-12H2,1-3H3/t14-,17+,18-,22-/m1/s1 |
| InChIKey | JUEKIYMZHXXJHU-AQHYUZTGSA-N |
| XLogP | 5.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|