C16H19N3O4 — CID 108817625
3-[[(Z)-2-cyano-3-[1-(4-methoxyphenyl)ethylamino]prop-2-enoyl]amino]propanoic acid (PubChem CID 108817625) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-[1-(4-methoxyphenyl)ethylamino]prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-[1-(4-methoxyphenyl)ethylamino]prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108817625 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-[1-(4-methoxyphenyl)ethylamino]prop-2-enoyl]amino]propanoic acid |
| SMILES | COc1ccc(C(C)N/C=C(/C#N)C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C16H19N3O4/c1-11(12-3-5-14(23-2)6-4-12)19-10-13(9-17)16(22)18-8-7-15(20)21/h3-6,10-11,19H,7-8H2,1-2H3,(H,18,22)(H,20,21)/b13-10- |
| InChIKey | NOLCKRFLTCWGCI-RAXLEYEMSA-N |
| XLogP | 1.34 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|