C16H21NO4S — CID 10881843
methyl (3aR,6aS)-2,2-dioxo-5-[(1R)-1-phenylethyl]-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-3a-carboxylate (PubChem CID 10881843) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is methyl (3aR,6aS)-2,2-dioxo-5-[(1R)-1-phenylethyl]-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-3a-carboxylate.
| Compound Name | methyl (3aR,6aS)-2,2-dioxo-5-[(1R)-1-phenylethyl]-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 10881843 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | methyl (3aR,6aS)-2,2-dioxo-5-[(1R)-1-phenylethyl]-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-3a-carboxylate |
| SMILES | COC(=O)[C@]12CN([C@H](C)c3ccccc3)C[C@H]1CS(=O)(=O)C2 |
| InChI | InChI=1S/C16H21NO4S/c1-12(13-6-4-3-5-7-13)17-8-14-9-22(19,20)11-16(14,10-17)15(18)21-2/h3-7,12,14H,8-11H2,1-2H3/t12-,14+,16+/m1/s1 |
| InChIKey | IOYQFWMKJAIXQN-INWMFGNUSA-N |
| XLogP | 1.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |