C19H36O2Si — CID 10881892
4-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]butan-2-one (PubChem CID 10881892) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is 4-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]butan-2-one.
| Compound Name | 4-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]butan-2-one |
|---|---|
| PubChem CID | 10881892 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 4-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]butan-2-one |
| SMILES | C=C1CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@@H]1CCC(C)=O |
| InChI | InChI=1S/C19H36O2Si/c1-14-10-13-17(21-22(8,9)18(3,4)5)19(6,7)16(14)12-11-15(2)20/h16-17H,1,10-13H2,2-9H3/t16-,17+/m1/s1 |
| InChIKey | GNEGMJLKFWABBQ-SJORKVTESA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|