About N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide
N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide (PubChem CID 10881965) has the molecular formula C10H9F3IN
and a molecular weight of 327.09 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide.
Molecular Properties
| Compound Name | N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide |
| PubChem CID | 10881965 |
| Molecular Formula | C10H9F3IN |
| Molecular Weight | 327.09 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide |
| SMILES | Cc1cccc(C)c1/N=C(\I)C(F)(F)F |
| InChI | InChI=1S/C10H9F3IN/c1-6-4-3-5-7(2)8(6)15-9(14)10(11,12)13/h3-5H,1-2H3/b15-9- |
| InChIKey | YQWZJPFEKLIAPA-DHDCSXOGSA-N |
| XLogP | 4.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.09 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide?
The IUPAC name of N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide (CID 10881965) is N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide.
What is the SMILES notation for N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide?
The canonical SMILES for N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide is Cc1cccc(C)c1/N=C(\I)C(F)(F)F.
What is the InChIKey of N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide?
The InChIKey is YQWZJPFEKLIAPA-DHDCSXOGSA-N. The full InChI is InChI=1S/C10H9F3IN/c1-6-4-3-5-7(2)8(6)15-9(14)10(11,12)13/h3-5H,1-2H3/b15-9-.
What are the key properties of N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide?
N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide has a molecular weight of 327.09 g/mol, XLogP of 4.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethylphenyl)-2,2,2-trifluoroethanimidoyl iodide is sourced from PubChem (CID 10881965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).