C15H26O6Si — CID 10882097
ethyl (1R,2R,6S)-6-acetyloxy-2-methoxy-4-trimethylsilyloxycyclohex-3-ene-1-carboxylate (PubChem CID 10882097) has the molecular formula C15H26O6Si and a molecular weight of 330.45 g/mol. Its IUPAC name is ethyl (1R,2R,6S)-6-acetyloxy-2-methoxy-4-trimethylsilyloxycyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,2R,6S)-6-acetyloxy-2-methoxy-4-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10882097 |
| Molecular Formula | C15H26O6Si |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | ethyl (1R,2R,6S)-6-acetyloxy-2-methoxy-4-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](OC(C)=O)CC(O[Si](C)(C)C)=C[C@H]1OC |
| InChI | InChI=1S/C15H26O6Si/c1-7-19-15(17)14-12(18-3)8-11(21-22(4,5)6)9-13(14)20-10(2)16/h8,12-14H,7,9H2,1-6H3/t12-,13+,14+/m1/s1 |
| InChIKey | ZMJUJZNUYMUBNC-RDBSUJKOSA-N |
| XLogP | 2.25 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|