C17H14ClN3O2 — CID 108821016
(Z)-3-(3-chloroanilino)-2-cyano-N-(2-methoxyphenyl)prop-2-enamide (PubChem CID 108821016) has the molecular formula C17H14ClN3O2 and a molecular weight of 327.77 g/mol. Its IUPAC name is (Z)-3-(3-chloroanilino)-2-cyano-N-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(3-chloroanilino)-2-cyano-N-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108821016 |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | (Z)-3-(3-chloroanilino)-2-cyano-N-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1NC(=O)/C(C#N)=C\Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H14ClN3O2/c1-23-16-8-3-2-7-15(16)21-17(22)12(10-19)11-20-14-6-4-5-13(18)9-14/h2-9,11,20H,1H3,(H,21,22)/b12-11- |
| InChIKey | FAJVEYSJBZYYNI-QXMHVHEDSA-N |
| XLogP | 3.81 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|