C21H34OSi — CID 10882108
[(3E,5E,7E,9E)-dodeca-3,5,7,9-tetraen-11-ynoxy]-tri(propan-2-yl)silane (PubChem CID 10882108) has the molecular formula C21H34OSi and a molecular weight of 330.59 g/mol. Its IUPAC name is [(3E,5E,7E,9E)-dodeca-3,5,7,9-tetraen-11-ynoxy]-tri(propan-2-yl)silane.
| Compound Name | [(3E,5E,7E,9E)-dodeca-3,5,7,9-tetraen-11-ynoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10882108 |
| Molecular Formula | C21H34OSi |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | [(3E,5E,7E,9E)-dodeca-3,5,7,9-tetraen-11-ynoxy]-tri(propan-2-yl)silane |
| SMILES | C#C/C=C/C=C/C=C/C=C/CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H34OSi/c1-8-9-10-11-12-13-14-15-16-17-18-22-23(19(2)3,20(4)5)21(6)7/h1,9-16,19-21H,17-18H2,2-7H3/b10-9+,12-11+,14-13+,16-15+ |
| InChIKey | RHBPULHHPXQPFF-IQXCVQKKSA-N |
| XLogP | 6.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|