C22H23NO2 — CID 10882182
[(Z)-(2,2,5-trimethyl-1-phenylhexa-3,4-dienylidene)amino] benzoate (PubChem CID 10882182) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is [(Z)-(2,2,5-trimethyl-1-phenylhexa-3,4-dienylidene)amino] benzoate.
| Compound Name | [(Z)-(2,2,5-trimethyl-1-phenylhexa-3,4-dienylidene)amino] benzoate |
|---|---|
| PubChem CID | 10882182 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | [(Z)-(2,2,5-trimethyl-1-phenylhexa-3,4-dienylidene)amino] benzoate |
| SMILES | CC(C)=C=CC(C)(C)/C(=N/OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H23NO2/c1-17(2)15-16-22(3,4)20(18-11-7-5-8-12-18)23-25-21(24)19-13-9-6-10-14-19/h5-14,16H,1-4H3/b23-20+ |
| InChIKey | LCPDAROVUPTVTR-BSYVCWPDSA-N |
| XLogP | 5.40 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|