C17H12Cl3N3O — CID 108822050
(Z)-N-(3-chloro-4-methylphenyl)-2-cyano-3-(2,4-dichloroanilino)prop-2-enamide (PubChem CID 108822050) has the molecular formula C17H12Cl3N3O and a molecular weight of 380.66 g/mol. Its IUPAC name is (Z)-N-(3-chloro-4-methylphenyl)-2-cyano-3-(2,4-dichloroanilino)prop-2-enamide.
| Compound Name | (Z)-N-(3-chloro-4-methylphenyl)-2-cyano-3-(2,4-dichloroanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108822050 |
| Molecular Formula | C17H12Cl3N3O |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | (Z)-N-(3-chloro-4-methylphenyl)-2-cyano-3-(2,4-dichloroanilino)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C\Nc2ccc(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl3N3O/c1-10-2-4-13(7-14(10)19)23-17(24)11(8-21)9-22-16-5-3-12(18)6-15(16)20/h2-7,9,22H,1H3,(H,23,24)/b11-9- |
| InChIKey | RJSCRSLGAAPUNR-LUAWRHEFSA-N |
| XLogP | 5.41 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|