About ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate
ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate (PubChem CID 10882284) has the molecular formula C18H21F2NO3
and a molecular weight of 337.37 g/mol. Its IUPAC name is ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate |
| PubChem CID | 10882284 |
| Molecular Formula | C18H21F2NO3 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1([C@H]2CN([C@@H](C)c3ccccc3)C(=O)C2(F)F)CC1 |
| InChI | InChI=1S/C18H21F2NO3/c1-3-24-16(23)17(9-10-17)14-11-21(15(22)18(14,19)20)12(2)13-7-5-4-6-8-13/h4-8,12,14H,3,9-11H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | OCZANYJDVIISMN-GXTWGEPZSA-N |
| XLogP | 3.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate?
The IUPAC name of ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate (CID 10882284) is ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate.
What is the SMILES notation for ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate?
The canonical SMILES for ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate is CCOC(=O)C1([C@H]2CN([C@@H](C)c3ccccc3)C(=O)C2(F)F)CC1.
What is the InChIKey of ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate?
The InChIKey is OCZANYJDVIISMN-GXTWGEPZSA-N. The full InChI is InChI=1S/C18H21F2NO3/c1-3-24-16(23)17(9-10-17)14-11-21(15(22)18(14,19)20)12(2)13-7-5-4-6-8-13/h4-8,12,14H,3,9-11H2,1-2H3/t12-,14+/m0/s1.
What are the key properties of ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate?
ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate has a molecular weight of 337.37 g/mol, XLogP of 3.18, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(3S)-4,4-difluoro-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]cyclopropane-1-carboxylate is sourced from PubChem (CID 10882284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).