C22H29NO2 — CID 10882333
(3S,6R,8R,10S,11S,12R,14R)-2,2,6-trimethyl-12-phenyl-9-oxa-1-azatetracyclo[8.5.0.03,8.011,14]pentadecan-15-one (PubChem CID 10882333) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (3S,6R,8R,10S,11S,12R,14R)-2,2,6-trimethyl-12-phenyl-9-oxa-1-azatetracyclo[8.5.0.03,8.011,14]pentadecan-15-one.
| Compound Name | (3S,6R,8R,10S,11S,12R,14R)-2,2,6-trimethyl-12-phenyl-9-oxa-1-azatetracyclo[8.5.0.03,8.011,14]pentadecan-15-one |
|---|---|
| PubChem CID | 10882333 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (3S,6R,8R,10S,11S,12R,14R)-2,2,6-trimethyl-12-phenyl-9-oxa-1-azatetracyclo[8.5.0.03,8.011,14]pentadecan-15-one |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1[C@@H]3[C@@H](C[C@H]3c3ccccc3)C(=O)N1C2(C)C |
| InChI | InChI=1S/C22H29NO2/c1-13-9-10-17-18(11-13)25-21-19-15(14-7-5-4-6-8-14)12-16(19)20(24)23(21)22(17,2)3/h4-8,13,15-19,21H,9-12H2,1-3H3/t13-,15+,16-,17-,18-,19+,21+/m1/s1 |
| InChIKey | UWUPHPOWQVSXOH-MPCQSINHSA-N |
| XLogP | 4.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |