C19H22N4O4 — CID 108823948
ethyl 4-[[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 108823948) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is ethyl 4-[[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 4-[[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108823948 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | ethyl 4-[[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)/C(C#N)=C\N2CCN(C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C19H22N4O4/c1-3-27-19(26)15-4-6-17(7-5-15)21-18(25)16(12-20)13-22-8-10-23(11-9-22)14(2)24/h4-7,13H,3,8-11H2,1-2H3,(H,21,25)/b16-13- |
| InChIKey | PEKZRTWIPPLXOP-SSZFMOIBSA-N |
| XLogP | 1.37 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|