C10F10O2 — CID 10882413
1,1,3,3,4,5,5,7,7,8-decafluorofuro[3,4-f][2]benzofuran (PubChem CID 10882413) has the molecular formula C10F10O2 and a molecular weight of 342.09 g/mol. Its IUPAC name is 1,1,3,3,4,5,5,7,7,8-decafluorofuro[3,4-f][2]benzofuran.
| Compound Name | 1,1,3,3,4,5,5,7,7,8-decafluorofuro[3,4-f][2]benzofuran |
|---|---|
| PubChem CID | 10882413 |
| Molecular Formula | C10F10O2 |
| Molecular Weight | 342.09 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 1,1,3,3,4,5,5,7,7,8-decafluorofuro[3,4-f][2]benzofuran |
| SMILES | Fc1c2c(c(F)c3c1C(F)(F)OC3(F)F)C(F)(F)OC2(F)F |
| InChI | InChI=1S/C10F10O2/c11-5-1-2(8(15,16)21-7(1,13)14)6(12)4-3(5)9(17,18)22-10(4,19)20 |
| InChIKey | RRTJJBGORKPFMH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.09 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |