C16H10Cl2N4O3 — CID 108825097
(Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(4-nitroanilino)prop-2-enamide (PubChem CID 108825097) has the molecular formula C16H10Cl2N4O3 and a molecular weight of 377.19 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(4-nitroanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(4-nitroanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108825097 |
| Molecular Formula | C16H10Cl2N4O3 |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(4-nitroanilino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc([N+](=O)[O-])cc1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H10Cl2N4O3/c17-13-2-1-3-14(15(13)18)21-16(23)10(8-19)9-20-11-4-6-12(7-5-11)22(24)25/h1-7,9,20H,(H,21,23)/b10-9- |
| InChIKey | FHBNFWCTNJRCAU-KTKRTIGZSA-N |
| XLogP | 4.36 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|