C24H30N2 — CID 10882541
1-N,3-N-bis(2,6-dimethylphenyl)-2,2,4,4-tetramethylcyclobutane-1,3-diimine (PubChem CID 10882541) has the molecular formula C24H30N2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 1-N,3-N-bis(2,6-dimethylphenyl)-2,2,4,4-tetramethylcyclobutane-1,3-diimine.
| Compound Name | 1-N,3-N-bis(2,6-dimethylphenyl)-2,2,4,4-tetramethylcyclobutane-1,3-diimine |
|---|---|
| PubChem CID | 10882541 |
| Molecular Formula | C24H30N2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 1-N,3-N-bis(2,6-dimethylphenyl)-2,2,4,4-tetramethylcyclobutane-1,3-diimine |
| SMILES | Cc1cccc(C)c1N=C1C(C)(C)C(=Nc2c(C)cccc2C)C1(C)C |
| InChI | InChI=1S/C24H30N2/c1-15-11-9-12-16(2)19(15)25-21-23(5,6)22(24(21,7)8)26-20-17(3)13-10-14-18(20)4/h9-14H,1-8H3/b25-21-,26-22+ |
| InChIKey | KBYPFOYHWAVKQN-KOUJMYIZSA-N |
| XLogP | 6.83 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|