C20H16Cl2N4O — CID 108825650
(Z)-2-cyano-N-(2,5-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethylamino]prop-2-enamide (PubChem CID 108825650) has the molecular formula C20H16Cl2N4O and a molecular weight of 399.28 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,5-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethylamino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,5-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108825650 |
| Molecular Formula | C20H16Cl2N4O |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | (Z)-2-cyano-N-(2,5-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethylamino]prop-2-enamide |
| SMILES | N#C/C(=C/NCCc1c[nH]c2ccccc12)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H16Cl2N4O/c21-15-5-6-17(22)19(9-15)26-20(27)14(10-23)11-24-8-7-13-12-25-18-4-2-1-3-16(13)18/h1-6,9,11-12,24-25H,7-8H2,(H,26,27)/b14-11- |
| InChIKey | OLBOSDSLDUDPBR-KAMYIIQDSA-N |
| XLogP | 4.65 |
| TPSA | 80.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|