About [(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate
[(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate (PubChem CID 10882693) has the molecular formula C20H32O5
and a molecular weight of 352.47 g/mol. Its IUPAC name is [(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate.
Molecular Properties
| Compound Name | [(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate |
| PubChem CID | 10882693 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | [(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate |
| SMILES | CCCCCC[C@H](OC(C)=O)[C@H](CCC1=CCCCC1=O)OC(C)=O |
| InChI | InChI=1S/C20H32O5/c1-4-5-6-7-12-19(24-15(2)21)20(25-16(3)22)14-13-17-10-8-9-11-18(17)23/h10,19-20H,4-9,11-14H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | LDHFTAKWMGMLNX-PMACEKPBSA-N |
| XLogP | 4.28 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate?
The IUPAC name of [(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate (CID 10882693) is [(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate.
What is the SMILES notation for [(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate?
The canonical SMILES for [(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate is CCCCCC[C@H](OC(C)=O)[C@H](CCC1=CCCCC1=O)OC(C)=O.
What is the InChIKey of [(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate?
The InChIKey is LDHFTAKWMGMLNX-PMACEKPBSA-N. The full InChI is InChI=1S/C20H32O5/c1-4-5-6-7-12-19(24-15(2)21)20(25-16(3)22)14-13-17-10-8-9-11-18(17)23/h10,19-20H,4-9,11-14H2,1-3H3/t19-,20-/m0/s1.
What are the key properties of [(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate?
[(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate has a molecular weight of 352.47 g/mol, XLogP of 4.28, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-3-acetyloxy-1-(6-oxocyclohexen-1-yl)decan-4-yl] acetate is sourced from PubChem (CID 10882693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).