C18H39N3Si2 — CID 10882738
2-N,3-N-di(propan-2-yl)-6-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)hexane-2,3-diimine (PubChem CID 10882738) has the molecular formula C18H39N3Si2 and a molecular weight of 353.70 g/mol. Its IUPAC name is 2-N,3-N-di(propan-2-yl)-6-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)hexane-2,3-diimine.
| Compound Name | 2-N,3-N-di(propan-2-yl)-6-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)hexane-2,3-diimine |
|---|---|
| PubChem CID | 10882738 |
| Molecular Formula | C18H39N3Si2 |
| Molecular Weight | 353.70 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | 2-N,3-N-di(propan-2-yl)-6-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)hexane-2,3-diimine |
| SMILES | CC(=N\C(C)C)/C(CCCN1[Si](C)(C)CC[Si]1(C)C)=N\C(C)C |
| InChI | InChI=1S/C18H39N3Si2/c1-15(2)19-17(5)18(20-16(3)4)11-10-12-21-22(6,7)13-14-23(21,8)9/h15-16H,10-14H2,1-9H3/b19-17+,20-18- |
| InChIKey | MXDWXMKDTFJJFN-NADBREJJSA-N |
| XLogP | 5.21 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.70 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|