C22H30N2O2 — CID 10882763
(1R,2S,6R,7S)-1,10,10-trimethyl-3-[(2S)-2-methylbutanoyl]-5-phenyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one (PubChem CID 10882763) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is (1R,2S,6R,7S)-1,10,10-trimethyl-3-[(2S)-2-methylbutanoyl]-5-phenyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one.
| Compound Name | (1R,2S,6R,7S)-1,10,10-trimethyl-3-[(2S)-2-methylbutanoyl]-5-phenyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one |
|---|---|
| PubChem CID | 10882763 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | (1R,2S,6R,7S)-1,10,10-trimethyl-3-[(2S)-2-methylbutanoyl]-5-phenyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one |
| SMILES | CC[C@H](C)C(=O)N1C(=O)N(c2ccccc2)[C@@H]2[C@H]3CC[C@@](C)([C@@H]21)C3(C)C |
| InChI | InChI=1S/C22H30N2O2/c1-6-14(2)19(25)24-18-17(16-12-13-22(18,5)21(16,3)4)23(20(24)26)15-10-8-7-9-11-15/h7-11,14,16-18H,6,12-13H2,1-5H3/t14-,16+,17+,18+,22-/m0/s1 |
| InChIKey | NZQFWWRJYFCEPO-YFOXJBNGSA-N |
| XLogP | 4.69 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |