C18H28O7 — CID 10882814
methyl (1S,2R,3S,4R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(methoxymethoxy)-4-methyl-5-oxobicyclo[2.2.2]octane-2-carboxylate (PubChem CID 10882814) has the molecular formula C18H28O7 and a molecular weight of 356.42 g/mol. Its IUPAC name is methyl (1S,2R,3S,4R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(methoxymethoxy)-4-methyl-5-oxobicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | methyl (1S,2R,3S,4R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(methoxymethoxy)-4-methyl-5-oxobicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 10882814 |
| Molecular Formula | C18H28O7 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | methyl (1S,2R,3S,4R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(methoxymethoxy)-4-methyl-5-oxobicyclo[2.2.2]octane-2-carboxylate |
| SMILES | COCO[C@@]12CC[C@@](C)(C(=O)C1)[C@@H]([C@H]1COC(C)(C)O1)[C@H]2C(=O)OC |
| InChI | InChI=1S/C18H28O7/c1-16(2)23-9-11(25-16)13-14(15(20)22-5)18(24-10-21-4)7-6-17(13,3)12(19)8-18/h11,13-14H,6-10H2,1-5H3/t11-,13+,14+,17+,18+/m1/s1 |
| InChIKey | OQTAXRPGCQERNC-MQTICVDDSA-N |
| XLogP | 1.68 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|