C22H32O4 — CID 10882921
(2S,5S,6R)-6-but-3-enyl-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-5-phenylmethoxyoxane (PubChem CID 10882921) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (2S,5S,6R)-6-but-3-enyl-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-5-phenylmethoxyoxane.
| Compound Name | (2S,5S,6R)-6-but-3-enyl-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-5-phenylmethoxyoxane |
|---|---|
| PubChem CID | 10882921 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (2S,5S,6R)-6-but-3-enyl-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-5-phenylmethoxyoxane |
| SMILES | C=CCC[C@H]1O[C@](C)([C@H]2COC(C)(C)O2)CC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H32O4/c1-5-6-12-19-18(23-15-17-10-8-7-9-11-17)13-14-22(4,25-19)20-16-24-21(2,3)26-20/h5,7-11,18-20H,1,6,12-16H2,2-4H3/t18-,19+,20+,22-/m0/s1 |
| InChIKey | CWSNYYCPTSIEIU-HIUFNZKISA-N |
| XLogP | 4.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|