C24H26O3 — CID 10882982
5-(1-benzofuran-2-yl)-2-[(1S,2S,5S)-5-methyl-2-prop-1-en-2-ylcyclohexyl]benzene-1,3-diol (PubChem CID 10882982) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 5-(1-benzofuran-2-yl)-2-[(1S,2S,5S)-5-methyl-2-prop-1-en-2-ylcyclohexyl]benzene-1,3-diol.
| Compound Name | 5-(1-benzofuran-2-yl)-2-[(1S,2S,5S)-5-methyl-2-prop-1-en-2-ylcyclohexyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 10882982 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 5-(1-benzofuran-2-yl)-2-[(1S,2S,5S)-5-methyl-2-prop-1-en-2-ylcyclohexyl]benzene-1,3-diol |
| SMILES | C=C(C)[C@H]1CC[C@H](C)C[C@@H]1c1c(O)cc(-c2cc3ccccc3o2)cc1O |
| InChI | InChI=1S/C24H26O3/c1-14(2)18-9-8-15(3)10-19(18)24-20(25)11-17(12-21(24)26)23-13-16-6-4-5-7-22(16)27-23/h4-7,11-13,15,18-19,25-26H,1,8-10H2,2-3H3/t15-,18+,19-/m0/s1 |
| InChIKey | UPLNMKNMLLBKKI-IPELMVKDSA-N |
| XLogP | 6.61 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|