C17H20BrN3O — CID 108830481
(Z)-3-(2-bromoanilino)-2-cyano-N-cyclohexyl-N-methylprop-2-enamide (PubChem CID 108830481) has the molecular formula C17H20BrN3O and a molecular weight of 362.27 g/mol. Its IUPAC name is (Z)-3-(2-bromoanilino)-2-cyano-N-cyclohexyl-N-methylprop-2-enamide.
| Compound Name | (Z)-3-(2-bromoanilino)-2-cyano-N-cyclohexyl-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 108830481 |
| Molecular Formula | C17H20BrN3O |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | (Z)-3-(2-bromoanilino)-2-cyano-N-cyclohexyl-N-methylprop-2-enamide |
| SMILES | CN(C(=O)/C(C#N)=C\Nc1ccccc1Br)C1CCCCC1 |
| InChI | InChI=1S/C17H20BrN3O/c1-21(14-7-3-2-4-8-14)17(22)13(11-19)12-20-16-10-6-5-9-15(16)18/h5-6,9-10,12,14,20H,2-4,7-8H2,1H3/b13-12- |
| InChIKey | LFZUWHVZFDLCMY-SEYXRHQNSA-N |
| XLogP | 4.06 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|