About N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide
N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 1088308) has the molecular formula C21H26N2O5S
and a molecular weight of 418.52 g/mol. Its IUPAC name is N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide |
| PubChem CID | 1088308 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(C(=O)NCc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C21H26N2O5S/c1-27-19-9-8-18(14-20(19)28-2)29(25,26)23-12-10-17(11-13-23)21(24)22-15-16-6-4-3-5-7-16/h3-9,14,17H,10-13,15H2,1-2H3,(H,22,24) |
| InChIKey | QIASBQZELXCCSZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide?
The IUPAC name of N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide (CID 1088308) is N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide.
What is the SMILES notation for N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide?
The canonical SMILES for N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide is COc1ccc(S(=O)(=O)N2CCC(C(=O)NCc3ccccc3)CC2)cc1OC.
What is the InChIKey of N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide?
The InChIKey is QIASBQZELXCCSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O5S/c1-27-19-9-8-18(14-20(19)28-2)29(25,26)23-12-10-17(11-13-23)21(24)22-15-16-6-4-3-5-7-16/h3-9,14,17H,10-13,15H2,1-2H3,(H,22,24).
What are the key properties of N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide?
N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide has a molecular weight of 418.52 g/mol, XLogP of 2.42, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide is sourced from PubChem (CID 1088308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).