C17H18ClNO4S — CID 10883099
methyl (2S,3R)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 10883099) has the molecular formula C17H18ClNO4S and a molecular weight of 367.85 g/mol. Its IUPAC name is methyl (2S,3R)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S,3R)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10883099 |
| Molecular Formula | C17H18ClNO4S |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | methyl (2S,3R)-3-chloro-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](NS(=O)(=O)c1ccc(C)cc1)[C@H](Cl)c1ccccc1 |
| InChI | InChI=1S/C17H18ClNO4S/c1-12-8-10-14(11-9-12)24(21,22)19-16(17(20)23-2)15(18)13-6-4-3-5-7-13/h3-11,15-16,19H,1-2H3/t15-,16-/m1/s1 |
| InChIKey | CWMHUPHLHLCPCS-HZPDHXFCSA-N |
| XLogP | 2.80 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|