C20H41BO3Si — CID 10883118
tert-butyl-[(Z,2R,3R)-2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-4-enoxy]-dimethylsilane (PubChem CID 10883118) has the molecular formula C20H41BO3Si and a molecular weight of 368.44 g/mol. Its IUPAC name is tert-butyl-[(Z,2R,3R)-2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,2R,3R)-2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10883118 |
| Molecular Formula | C20H41BO3Si |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | tert-butyl-[(Z,2R,3R)-2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-4-enoxy]-dimethylsilane |
| SMILES | C[C@H](/C=C\CB1OC(C)(C)C(C)(C)O1)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H41BO3Si/c1-16(17(2)15-22-25(10,11)18(3,4)5)13-12-14-21-23-19(6,7)20(8,9)24-21/h12-13,16-17H,14-15H2,1-11H3/b13-12-/t16-,17+/m1/s1 |
| InChIKey | FMMVJUCTKNWPSU-MCYMDBPJSA-N |
| XLogP | 5.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|