C18H27ClOSe — CID 10883257
ethyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-phenylselanium chloride (PubChem CID 10883257) has the molecular formula C18H27ClOSe and a molecular weight of 373.83 g/mol. Its IUPAC name is ethyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-phenylselanium chloride.
| Compound Name | ethyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-phenylselanium chloride |
|---|---|
| PubChem CID | 10883257 |
| Molecular Formula | C18H27ClOSe |
| Molecular Weight | 373.83 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | ethyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-phenylselanium chloride |
| SMILES | CC[Se+](C[C@]12CC[C@H](C[C@H]1O)C2(C)C)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C18H27OSe.ClH/c1-4-20(15-8-6-5-7-9-15)13-18-11-10-14(12-16(18)19)17(18,2)3;/h5-9,14,16,19H,4,10-13H2,1-3H3;1H/q+1;/p-1/t14-,16-,18-,20?;/m1./s1 |
| InChIKey | BFHMVQMORNBHOU-YXRSBEMPSA-M |
| XLogP | 0.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.83 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|