C14H16FN3O — CID 108833646
(Z)-N-butyl-2-cyano-3-(4-fluoroanilino)prop-2-enamide (PubChem CID 108833646) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is (Z)-N-butyl-2-cyano-3-(4-fluoroanilino)prop-2-enamide.
| Compound Name | (Z)-N-butyl-2-cyano-3-(4-fluoroanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108833646 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (Z)-N-butyl-2-cyano-3-(4-fluoroanilino)prop-2-enamide |
| SMILES | CCCCNC(=O)/C(C#N)=C\Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H16FN3O/c1-2-3-8-17-14(19)11(9-16)10-18-13-6-4-12(15)5-7-13/h4-7,10,18H,2-3,8H2,1H3,(H,17,19)/b11-10- |
| InChIKey | FZXMYMJZEZTJRG-KHPPLWFESA-N |
| XLogP | 2.56 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|