C22H15FO3S — CID 10883376
(2S,3R,3'S)-3'-(4-fluorophenyl)-1-oxo-2-phenylspiro[2H-thiochromene-3,2'-oxirane]-4-one (PubChem CID 10883376) has the molecular formula C22H15FO3S and a molecular weight of 378.42 g/mol. Its IUPAC name is (2S,3R,3'S)-3'-(4-fluorophenyl)-1-oxo-2-phenylspiro[2H-thiochromene-3,2'-oxirane]-4-one.
| Compound Name | (2S,3R,3'S)-3'-(4-fluorophenyl)-1-oxo-2-phenylspiro[2H-thiochromene-3,2'-oxirane]-4-one |
|---|---|
| PubChem CID | 10883376 |
| Molecular Formula | C22H15FO3S |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (2S,3R,3'S)-3'-(4-fluorophenyl)-1-oxo-2-phenylspiro[2H-thiochromene-3,2'-oxirane]-4-one |
| SMILES | O=C1c2ccccc2S(=O)[C@@H](c2ccccc2)[C@]12O[C@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C22H15FO3S/c23-16-12-10-14(11-13-16)20-22(26-20)19(24)17-8-4-5-9-18(17)27(25)21(22)15-6-2-1-3-7-15/h1-13,20-21H/t20-,21-,22-,27?/m0/s1 |
| InChIKey | KAESFISWAYXHGE-DLMFWBLPSA-N |
| XLogP | 4.38 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|