About N-(furan-2-ylmethyl)-2,4-dimethylbenzamide
N-(furan-2-ylmethyl)-2,4-dimethylbenzamide (PubChem CID 1088346) has the molecular formula C14H15NO2
and a molecular weight of 229.28 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2,4-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-2,4-dimethylbenzamide |
| PubChem CID | 1088346 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2ccco2)c(C)c1 |
| InChI | InChI=1S/C14H15NO2/c1-10-5-6-13(11(2)8-10)14(16)15-9-12-4-3-7-17-12/h3-8H,9H2,1-2H3,(H,15,16) |
| InChIKey | OZULURZXTBOIPR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(furan-2-ylmethyl)-2,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-2,4-dimethylbenzamide?
The IUPAC name of N-(furan-2-ylmethyl)-2,4-dimethylbenzamide (CID 1088346) is N-(furan-2-ylmethyl)-2,4-dimethylbenzamide.
What is the SMILES notation for N-(furan-2-ylmethyl)-2,4-dimethylbenzamide?
The canonical SMILES for N-(furan-2-ylmethyl)-2,4-dimethylbenzamide is Cc1ccc(C(=O)NCc2ccco2)c(C)c1.
What is the InChIKey of N-(furan-2-ylmethyl)-2,4-dimethylbenzamide?
The InChIKey is OZULURZXTBOIPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2/c1-10-5-6-13(11(2)8-10)14(16)15-9-12-4-3-7-17-12/h3-8H,9H2,1-2H3,(H,15,16).
What are the key properties of N-(furan-2-ylmethyl)-2,4-dimethylbenzamide?
N-(furan-2-ylmethyl)-2,4-dimethylbenzamide has a molecular weight of 229.28 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-2,4-dimethylbenzamide is sourced from PubChem (CID 1088346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).