C20H20FN3O — CID 108835304
(Z)-2-cyano-3-[2-(4-fluorophenyl)ethylamino]-N-(2-phenylethyl)prop-2-enamide (PubChem CID 108835304) has the molecular formula C20H20FN3O and a molecular weight of 337.40 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2-(4-fluorophenyl)ethylamino]-N-(2-phenylethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2-(4-fluorophenyl)ethylamino]-N-(2-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108835304 |
| Molecular Formula | C20H20FN3O |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | (Z)-2-cyano-3-[2-(4-fluorophenyl)ethylamino]-N-(2-phenylethyl)prop-2-enamide |
| SMILES | N#C/C(=C/NCCc1ccc(F)cc1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C20H20FN3O/c21-19-8-6-17(7-9-19)10-12-23-15-18(14-22)20(25)24-13-11-16-4-2-1-3-5-16/h1-9,15,23H,10-13H2,(H,24,25)/b18-15- |
| InChIKey | WAEPZJWFOXLYBR-SDXDJHTJSA-N |
| XLogP | 2.72 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|