About N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide
N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide (PubChem CID 1088354) has the molecular formula C21H20N2O3S
and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide |
| PubChem CID | 1088354 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc(C)cc2C)ccc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C21H20N2O3S/c1-13-6-8-16(14(2)11-13)20(24)22-15-7-9-17(18(12-15)26-3)23-21(25)19-5-4-10-27-19/h4-12H,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | UXLVPMBIQPAHQX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide?
The IUPAC name of N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide (CID 1088354) is N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide.
What is the SMILES notation for N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide?
The canonical SMILES for N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide is COc1cc(NC(=O)c2ccc(C)cc2C)ccc1NC(=O)c1cccs1.
What is the InChIKey of N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide?
The InChIKey is UXLVPMBIQPAHQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O3S/c1-13-6-8-16(14(2)11-13)20(24)22-15-7-9-17(18(12-15)26-3)23-21(25)19-5-4-10-27-19/h4-12H,1-3H3,(H,22,24)(H,23,25).
What are the key properties of N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide?
N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide has a molecular weight of 380.47 g/mol, XLogP of 4.88, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2,4-dimethylbenzoyl)amino]-2-methoxyphenyl]thiophene-2-carboxamide is sourced from PubChem (CID 1088354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).