About (4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol
(4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol (PubChem CID 10883666) has the molecular formula C25H26O2S
and a molecular weight of 390.55 g/mol. Its IUPAC name is (4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol.
Molecular Properties
| Compound Name | (4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol |
| PubChem CID | 10883666 |
| Molecular Formula | C25H26O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol |
| SMILES | COCCCCC#C/C(=C\c1ccccc1CS)C(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C25H26O2S/c1-27-18-10-3-2-7-14-23(19-22-13-8-9-15-24(22)20-28)25(26)17-16-21-11-5-4-6-12-21/h4-6,8-9,11-13,15,19,25-26,28H,2-3,10,18,20H2,1H3/b23-19+ |
| InChIKey | QFWUSXFUGDATEX-FCDQGJHFSA-N |
| XLogP | 4.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol?
The IUPAC name of (4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol (CID 10883666) is (4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol.
What is the SMILES notation for (4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol?
The canonical SMILES for (4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol is COCCCCC#C/C(=C\c1ccccc1CS)C(O)C#Cc1ccccc1.
What is the InChIKey of (4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol?
The InChIKey is QFWUSXFUGDATEX-FCDQGJHFSA-N. The full InChI is InChI=1S/C25H26O2S/c1-27-18-10-3-2-7-14-23(19-22-13-8-9-15-24(22)20-28)25(26)17-16-21-11-5-4-6-12-21/h4-6,8-9,11-13,15,19,25-26,28H,2-3,10,18,20H2,1H3/b23-19+.
What are the key properties of (4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol?
(4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol has a molecular weight of 390.55 g/mol, XLogP of 4.73, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-10-methoxy-1-phenyl-4-[[2-(sulfanylmethyl)phenyl]methylidene]deca-1,5-diyn-3-ol is sourced from PubChem (CID 10883666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).