C16H13ClN4O — CID 108837382
(Z)-3-(4-chloroanilino)-2-cyano-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 108837382) has the molecular formula C16H13ClN4O and a molecular weight of 312.76 g/mol. Its IUPAC name is (Z)-3-(4-chloroanilino)-2-cyano-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-3-(4-chloroanilino)-2-cyano-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108837382 |
| Molecular Formula | C16H13ClN4O |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (Z)-3-(4-chloroanilino)-2-cyano-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(Cl)cc1)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C16H13ClN4O/c17-14-3-5-15(6-4-14)20-11-13(8-18)16(22)21-10-12-2-1-7-19-9-12/h1-7,9,11,20H,10H2,(H,21,22)/b13-11- |
| InChIKey | XJGMBYXFMYCRQQ-QBFSEMIESA-N |
| XLogP | 2.87 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|