C23H26ClNO3 — CID 10883878
prop-2-enyl N-[(6R,7R,10aR)-6-chloro-7-ethenyl-7,10,10-trimethyl-8-oxo-6,10a-dihydro-5H-anthracen-1-yl]carbamate (PubChem CID 10883878) has the molecular formula C23H26ClNO3 and a molecular weight of 399.92 g/mol. Its IUPAC name is prop-2-enyl N-[(6R,7R,10aR)-6-chloro-7-ethenyl-7,10,10-trimethyl-8-oxo-6,10a-dihydro-5H-anthracen-1-yl]carbamate.
| Compound Name | prop-2-enyl N-[(6R,7R,10aR)-6-chloro-7-ethenyl-7,10,10-trimethyl-8-oxo-6,10a-dihydro-5H-anthracen-1-yl]carbamate |
|---|---|
| PubChem CID | 10883878 |
| Molecular Formula | C23H26ClNO3 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | prop-2-enyl N-[(6R,7R,10aR)-6-chloro-7-ethenyl-7,10,10-trimethyl-8-oxo-6,10a-dihydro-5H-anthracen-1-yl]carbamate |
| SMILES | C=CCOC(=O)Nc1cccc2c1C=C1C(=O)[C@@](C)(C=C)[C@H](Cl)C[C@@H]1C2(C)C |
| InChI | InChI=1S/C23H26ClNO3/c1-6-11-28-21(27)25-18-10-8-9-16-14(18)12-15-17(22(16,3)4)13-19(24)23(5,7-2)20(15)26/h6-10,12,17,19H,1-2,11,13H2,3-5H3,(H,25,27)/t17-,19+,23-/m0/s1 |
| InChIKey | ZYXFISDKZXTBTF-GWJPWWOOSA-N |
| XLogP | 5.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|