About (2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine
(2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine (PubChem CID 10883894) has the molecular formula C22H28N2O3S
and a molecular weight of 400.54 g/mol. Its IUPAC name is (2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | (2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine |
| PubChem CID | 10883894 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine |
| SMILES | O=S(=O)(c1ccccc1)N1[C@H](Cc2ccccc2)CO[C@H]1CC1CCNCC1 |
| InChI | InChI=1S/C22H28N2O3S/c25-28(26,21-9-5-2-6-10-21)24-20(15-18-7-3-1-4-8-18)17-27-22(24)16-19-11-13-23-14-12-19/h1-10,19-20,22-23H,11-17H2/t20-,22+/m1/s1 |
| InChIKey | KSDILXOKSSGRBI-IRLDBZIGSA-N |
| XLogP | 3.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine?
The IUPAC name of (2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine (CID 10883894) is (2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine.
What is the SMILES notation for (2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine?
The canonical SMILES for (2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine is O=S(=O)(c1ccccc1)N1[C@H](Cc2ccccc2)CO[C@H]1CC1CCNCC1.
What is the InChIKey of (2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine?
The InChIKey is KSDILXOKSSGRBI-IRLDBZIGSA-N. The full InChI is InChI=1S/C22H28N2O3S/c25-28(26,21-9-5-2-6-10-21)24-20(15-18-7-3-1-4-8-18)17-27-22(24)16-19-11-13-23-14-12-19/h1-10,19-20,22-23H,11-17H2/t20-,22+/m1/s1.
What are the key properties of (2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine?
(2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine has a molecular weight of 400.54 g/mol, XLogP of 3.03, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-3-(benzenesulfonyl)-4-benzyl-2-(piperidin-4-ylmethyl)-1,3-oxazolidine is sourced from PubChem (CID 10883894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).