About methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate
methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate (PubChem CID 1088392) has the molecular formula C17H16N2O5S
and a molecular weight of 360.39 g/mol. Its IUPAC name is methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate |
| PubChem CID | 1088392 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(NC(=O)c2c(OC)cccc2OC)c(C#N)c1C |
| InChI | InChI=1S/C17H16N2O5S/c1-9-10(8-18)16(25-14(9)17(21)24-4)19-15(20)13-11(22-2)6-5-7-12(13)23-3/h5-7H,1-4H3,(H,19,20) |
| InChIKey | SBFUWAJSNMHPOF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate?
The IUPAC name of methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate (CID 1088392) is methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate.
What is the SMILES notation for methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate?
The canonical SMILES for methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate is COC(=O)c1sc(NC(=O)c2c(OC)cccc2OC)c(C#N)c1C.
What is the InChIKey of methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate?
The InChIKey is SBFUWAJSNMHPOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O5S/c1-9-10(8-18)16(25-14(9)17(21)24-4)19-15(20)13-11(22-2)6-5-7-12(13)23-3/h5-7H,1-4H3,(H,19,20).
What are the key properties of methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate?
methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate has a molecular weight of 360.39 g/mol, XLogP of 2.98, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-cyano-5-[(2,6-dimethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate is sourced from PubChem (CID 1088392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).