C18H24N4O2 — CID 108839999
(Z)-2-cyano-3-(2-morpholin-4-ylethylamino)-N-(1-phenylethyl)prop-2-enamide (PubChem CID 108839999) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-morpholin-4-ylethylamino)-N-(1-phenylethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-morpholin-4-ylethylamino)-N-(1-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108839999 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (Z)-2-cyano-3-(2-morpholin-4-ylethylamino)-N-(1-phenylethyl)prop-2-enamide |
| SMILES | CC(NC(=O)/C(C#N)=C\NCCN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C18H24N4O2/c1-15(16-5-3-2-4-6-16)21-18(23)17(13-19)14-20-7-8-22-9-11-24-12-10-22/h2-6,14-15,20H,7-12H2,1H3,(H,21,23)/b17-14- |
| InChIKey | RYXOJOFJRXYVAB-VKAVYKQESA-N |
| XLogP | 1.19 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|