C20H19N7OS — CID 10884000
4-(furan-2-yl)-12-methylsulfanyl-11-(3-phenylpropyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine (PubChem CID 10884000) has the molecular formula C20H19N7OS and a molecular weight of 405.49 g/mol. Its IUPAC name is 4-(furan-2-yl)-12-methylsulfanyl-11-(3-phenylpropyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine.
| Compound Name | 4-(furan-2-yl)-12-methylsulfanyl-11-(3-phenylpropyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine |
|---|---|
| PubChem CID | 10884000 |
| Molecular Formula | C20H19N7OS |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 4-(furan-2-yl)-12-methylsulfanyl-11-(3-phenylpropyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine |
| SMILES | CSc1c2c(nc(N)n3nc(-c4ccco4)nc23)nn1CCCc1ccccc1 |
| InChI | InChI=1S/C20H19N7OS/c1-29-19-15-17(24-26(19)11-5-9-13-7-3-2-4-8-13)23-20(21)27-18(15)22-16(25-27)14-10-6-12-28-14/h2-4,6-8,10,12H,5,9,11H2,1H3,(H2,21,23,24) |
| InChIKey | UKNAWBIMMPPIBW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |