C26H32O2S — CID 10884063
(1S,2E,4R,8R)-4-(benzenesulfinyl)-2-benzylidene-1-pentyl-9-oxabicyclo[6.1.0]nonane (PubChem CID 10884063) has the molecular formula C26H32O2S and a molecular weight of 408.61 g/mol. Its IUPAC name is (1S,2E,4R,8R)-4-(benzenesulfinyl)-2-benzylidene-1-pentyl-9-oxabicyclo[6.1.0]nonane.
| Compound Name | (1S,2E,4R,8R)-4-(benzenesulfinyl)-2-benzylidene-1-pentyl-9-oxabicyclo[6.1.0]nonane |
|---|---|
| PubChem CID | 10884063 |
| Molecular Formula | C26H32O2S |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (1S,2E,4R,8R)-4-(benzenesulfinyl)-2-benzylidene-1-pentyl-9-oxabicyclo[6.1.0]nonane |
| SMILES | CCCCC[C@@]12O[C@@H]1CCC[C@@H](S(=O)c1ccccc1)C/C2=C\c1ccccc1 |
| InChI | InChI=1S/C26H32O2S/c1-2-3-10-18-26-22(19-21-12-6-4-7-13-21)20-24(16-11-17-25(26)28-26)29(27)23-14-8-5-9-15-23/h4-9,12-15,19,24-25H,2-3,10-11,16-18,20H2,1H3/b22-19+/t24-,25-,26+,29?/m1/s1 |
| InChIKey | ZJOOSPHAVKVYLM-ZEEGTDJKSA-N |
| XLogP | 6.54 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|