C23H25NO6 — CID 10884112
1-[(1S,2R,6R,7S,9R,12R)-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]ethanone (PubChem CID 10884112) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is 1-[(1S,2R,6R,7S,9R,12R)-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]ethanone.
| Compound Name | 1-[(1S,2R,6R,7S,9R,12R)-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]ethanone |
|---|---|
| PubChem CID | 10884112 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-[(1S,2R,6R,7S,9R,12R)-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]ethanone |
| SMILES | CC(=O)N1CO[C@H]2[C@@H]3O[C@H](c4ccccc4)OC[C@H]3O[C@H](OCc3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C23H25NO6/c1-15(25)24-14-28-21-19(24)23(26-12-16-8-4-2-5-9-16)29-18-13-27-22(30-20(18)21)17-10-6-3-7-11-17/h2-11,18-23H,12-14H2,1H3/t18-,19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | YJMPJENMLYUKSG-RCQJKQRMSA-N |
| XLogP | 2.62 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |