C20H36O7Si — CID 10884227
dimethyl (3R,4aR,5R,8aS)-5-(methoxymethoxy)-4a-methyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,8a-octahydronaphthalene-1,1-dicarboxylate (PubChem CID 10884227) has the molecular formula C20H36O7Si and a molecular weight of 416.59 g/mol. Its IUPAC name is dimethyl (3R,4aR,5R,8aS)-5-(methoxymethoxy)-4a-methyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,8a-octahydronaphthalene-1,1-dicarboxylate.
| Compound Name | dimethyl (3R,4aR,5R,8aS)-5-(methoxymethoxy)-4a-methyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,8a-octahydronaphthalene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10884227 |
| Molecular Formula | C20H36O7Si |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | dimethyl (3R,4aR,5R,8aS)-5-(methoxymethoxy)-4a-methyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,8a-octahydronaphthalene-1,1-dicarboxylate |
| SMILES | COCO[C@@H]1CCC[C@@H]2C(C(=O)OC)(C(=O)OC)C[C@H](O[Si](C)(C)C)C[C@]21C |
| InChI | InChI=1S/C20H36O7Si/c1-19-11-14(27-28(5,6)7)12-20(17(21)24-3,18(22)25-4)15(19)9-8-10-16(19)26-13-23-2/h14-16H,8-13H2,1-7H3/t14-,15+,16-,19-/m1/s1 |
| InChIKey | MGKASAOLZVSXBO-YYAJDYIMSA-N |
| XLogP | 3.13 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|