C25H44OSi2 — CID 10884235
triethyl-[2,4,4-trimethyl-3-[(1E,3E)-3-methyl-6-trimethylsilylhexa-1,3-dien-5-ynyl]cyclohex-2-en-1-yl]oxysilane (PubChem CID 10884235) has the molecular formula C25H44OSi2 and a molecular weight of 416.80 g/mol. Its IUPAC name is triethyl-[2,4,4-trimethyl-3-[(1E,3E)-3-methyl-6-trimethylsilylhexa-1,3-dien-5-ynyl]cyclohex-2-en-1-yl]oxysilane.
| Compound Name | triethyl-[2,4,4-trimethyl-3-[(1E,3E)-3-methyl-6-trimethylsilylhexa-1,3-dien-5-ynyl]cyclohex-2-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 10884235 |
| Molecular Formula | C25H44OSi2 |
| Molecular Weight | 416.80 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | triethyl-[2,4,4-trimethyl-3-[(1E,3E)-3-methyl-6-trimethylsilylhexa-1,3-dien-5-ynyl]cyclohex-2-en-1-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)OC1CCC(C)(C)C(/C=C/C(C)=C/C#C[Si](C)(C)C)=C1C |
| InChI | InChI=1S/C25H44OSi2/c1-11-28(12-2,13-3)26-24-18-19-25(6,7)23(22(24)5)17-16-21(4)15-14-20-27(8,9)10/h15-17,24H,11-13,18-19H2,1-10H3/b17-16+,21-15+ |
| InChIKey | LZLYSMDZCXZZNK-IUEIKPRBSA-N |
| XLogP | 7.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.80 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|