C20H36BrNO3 — CID 10884266
[(E)-4-ethoxy-3-methyl-4-oxobut-2-enyl]-[(6Z)-8-methoxy-2,6-dimethylocta-1,6-dien-3-yl]-dimethylazanium bromide (PubChem CID 10884266) has the molecular formula C20H36BrNO3 and a molecular weight of 418.42 g/mol. Its IUPAC name is [(E)-4-ethoxy-3-methyl-4-oxobut-2-enyl]-[(6Z)-8-methoxy-2,6-dimethylocta-1,6-dien-3-yl]-dimethylazanium bromide.
| Compound Name | [(E)-4-ethoxy-3-methyl-4-oxobut-2-enyl]-[(6Z)-8-methoxy-2,6-dimethylocta-1,6-dien-3-yl]-dimethylazanium bromide |
|---|---|
| PubChem CID | 10884266 |
| Molecular Formula | C20H36BrNO3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [(E)-4-ethoxy-3-methyl-4-oxobut-2-enyl]-[(6Z)-8-methoxy-2,6-dimethylocta-1,6-dien-3-yl]-dimethylazanium bromide |
| SMILES | C=C(C)C(CC/C(C)=C\COC)[N+](C)(C)C/C=C(\C)C(=O)OCC.[Br-] |
| InChI | InChI=1S/C20H36NO3.BrH/c1-9-24-20(22)18(5)12-14-21(6,7)19(16(2)3)11-10-17(4)13-15-23-8;/h12-13,19H,2,9-11,14-15H2,1,3-8H3;1H/q+1;/p-1/b17-13-,18-12+; |
| InChIKey | AODXGAKKOYEGSE-SGKZHYJVSA-M |
| XLogP | 0.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|