About CID 10884286
CID 10884286 (PubChem CID 10884286) has the molecular formula C18H20NOS
and a molecular weight of 298.43 g/mol.
Molecular Properties
| Compound Name | CID 10884286 |
| PubChem CID | 10884286 |
| Molecular Formula | C18H20NOS |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[C@H]1CN=C([C]2[CH][CH][CH][C]2Sc2ccccc2)O1 |
| InChI | InChI=1S/C18H20NOS/c1-18(2,3)16-12-19-17(20-16)14-10-7-11-15(14)21-13-8-5-4-6-9-13/h4-11,16H,12H2,1-3H3/t16-/m1/s1 |
| InChIKey | TZRVLLOUWYFPFA-MRXNPFEDSA-N |
| XLogP | 4.36 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 10884286 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10884286?
The IUPAC name of CID 10884286 (CID 10884286) is not available.
What is the SMILES notation for CID 10884286?
The canonical SMILES for CID 10884286 is CC(C)(C)[C@H]1CN=C([C]2[CH][CH][CH][C]2Sc2ccccc2)O1.
What is the InChIKey of CID 10884286?
The InChIKey is TZRVLLOUWYFPFA-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H20NOS/c1-18(2,3)16-12-19-17(20-16)14-10-7-11-15(14)21-13-8-5-4-6-9-13/h4-11,16H,12H2,1-3H3/t16-/m1/s1.
What are the key properties of CID 10884286?
CID 10884286 has a molecular weight of 298.43 g/mol, XLogP of 4.36, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10884286 is sourced from PubChem (CID 10884286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).