C11H15N3O4 — CID 108843555
3-[[(Z)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]amino]propanoic acid (PubChem CID 108843555) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]amino]propanoic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108843555 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]amino]propanoic acid |
| SMILES | N#C/C(=C/NCCC(=O)O)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C11H15N3O4/c12-7-9(8-13-2-1-10(15)16)11(17)14-3-5-18-6-4-14/h8,13H,1-6H2,(H,15,16)/b9-8- |
| InChIKey | DYBQNYOPVWGQSI-HJWRWDBZSA-N |
| XLogP | -0.68 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|