C23H29NO5Si — CID 10884442
(6S,7R,8R,8aR)-8-[tert-butyl(diphenyl)silyl]oxy-6,7-dihydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 10884442) has the molecular formula C23H29NO5Si and a molecular weight of 427.57 g/mol. Its IUPAC name is (6S,7R,8R,8aR)-8-[tert-butyl(diphenyl)silyl]oxy-6,7-dihydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (6S,7R,8R,8aR)-8-[tert-butyl(diphenyl)silyl]oxy-6,7-dihydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 10884442 |
| Molecular Formula | C23H29NO5Si |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (6S,7R,8R,8aR)-8-[tert-butyl(diphenyl)silyl]oxy-6,7-dihydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | CC(C)(C)[Si](O[C@H]1[C@H](O)[C@@H](O)CN2C(=O)OC[C@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H29NO5Si/c1-23(2,3)30(16-10-6-4-7-11-16,17-12-8-5-9-13-17)29-21-18-15-28-22(27)24(18)14-19(25)20(21)26/h4-13,18-21,25-26H,14-15H2,1-3H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | RJRPWMIVEOZQFM-PLACYPQZSA-N |
| XLogP | 1.49 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|